C25H38O2 — CID 140679121
1-[(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoxy]-3-methylbutan-2-one (PubChem CID 140679121) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 1-[(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoxy]-3-methylbutan-2-one.
| Compound Name | 1-[(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoxy]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 140679121 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 1-[(2Z,5Z,8Z,11Z,14Z,17Z)-icosa-2,5,8,11,14,17-hexaenoxy]-3-methylbutan-2-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\COCC(=O)C(C)C |
| InChI | InChI=1S/C25H38O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-23-25(26)24(2)3/h5-6,8-9,11-12,14-15,17-18,20-21,24H,4,7,10,13,16,19,22-23H2,1-3H3/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | OFUKZWCVKIQDMC-YNUSHXQLSA-N |
| XLogP | 6.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|