C15H32O — CID 140680514
3,4,5-trimethyl-3-(3-methylbutan-2-yl)heptan-2-ol (PubChem CID 140680514) has the molecular formula C15H32O and a molecular weight of 228.42 g/mol. Its IUPAC name is 3,4,5-trimethyl-3-(3-methylbutan-2-yl)heptan-2-ol.
| Compound Name | 3,4,5-trimethyl-3-(3-methylbutan-2-yl)heptan-2-ol |
|---|---|
| PubChem CID | 140680514 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | 3,4,5-trimethyl-3-(3-methylbutan-2-yl)heptan-2-ol |
| SMILES | CCC(C)C(C)C(C)(C(C)O)C(C)C(C)C |
| InChI | InChI=1S/C15H32O/c1-9-11(4)13(6)15(8,14(7)16)12(5)10(2)3/h10-14,16H,9H2,1-8H3 |
| InChIKey | DHHPOBBHYHECAW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |