C24H28FN5O2 — CID 140681376
N-[(E)-(5-fluoro-2-hydroxy-3-propylphenyl)methylideneamino]-2-[4-[(4-isocyanophenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 140681376) has the molecular formula C24H28FN5O2 and a molecular weight of 437.52 g/mol. Its IUPAC name is N-[(E)-(5-fluoro-2-hydroxy-3-propylphenyl)methylideneamino]-2-[4-[(4-isocyanophenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[(E)-(5-fluoro-2-hydroxy-3-propylphenyl)methylideneamino]-2-[4-[(4-isocyanophenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 140681376 |
| Molecular Formula | C24H28FN5O2 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-[(E)-(5-fluoro-2-hydroxy-3-propylphenyl)methylideneamino]-2-[4-[(4-isocyanophenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | [C-]#[N+]c1ccc(CN2CCN(CC(=O)N/N=C/c3cc(F)cc(CCC)c3O)CC2)cc1 |
| InChI | InChI=1S/C24H28FN5O2/c1-3-4-19-13-21(25)14-20(24(19)32)15-27-28-23(31)17-30-11-9-29(10-12-30)16-18-5-7-22(26-2)8-6-18/h5-8,13-15,32H,3-4,9-12,16-17H2,1H3,(H,28,31)/b27-15+ |
| InChIKey | VDSZMNHMDABFBZ-JFLMPSFJSA-N |
| XLogP | 3.30 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|