C16H21ClFNO4S — CID 140683935
N-[chloro-(2-cyclohexylethoxy)-fluoromethyl]sulfonylbenzamide (PubChem CID 140683935) has the molecular formula C16H21ClFNO4S and a molecular weight of 377.87 g/mol. Its IUPAC name is N-[chloro-(2-cyclohexylethoxy)-fluoromethyl]sulfonylbenzamide.
| Compound Name | N-[chloro-(2-cyclohexylethoxy)-fluoromethyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 140683935 |
| Molecular Formula | C16H21ClFNO4S |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[chloro-(2-cyclohexylethoxy)-fluoromethyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)C(F)(Cl)OCCC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H21ClFNO4S/c17-16(18,23-12-11-13-7-3-1-4-8-13)24(21,22)19-15(20)14-9-5-2-6-10-14/h2,5-6,9-10,13H,1,3-4,7-8,11-12H2,(H,19,20) |
| InChIKey | BKXNMAZBTHKEBP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|