C31H37N5O4 — CID 140684119
tert-butyl N-[1-[3-(benzamidocarbamoyl)-5-(3,5-dimethylphenyl)-4-pyridinyl]piperidin-4-yl]carbamate (PubChem CID 140684119) has the molecular formula C31H37N5O4 and a molecular weight of 543.67 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(benzamidocarbamoyl)-5-(3,5-dimethylphenyl)-4-pyridinyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(benzamidocarbamoyl)-5-(3,5-dimethylphenyl)-4-pyridinyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 140684119 |
| Molecular Formula | C31H37N5O4 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | tert-butyl N-[1-[3-(benzamidocarbamoyl)-5-(3,5-dimethylphenyl)-4-pyridinyl]piperidin-4-yl]carbamate |
| SMILES | Cc1cc(C)cc(-c2cncc(C(=O)NNC(=O)c3ccccc3)c2N2CCC(NC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C31H37N5O4/c1-20-15-21(2)17-23(16-20)25-18-32-19-26(29(38)35-34-28(37)22-9-7-6-8-10-22)27(25)36-13-11-24(12-14-36)33-30(39)40-31(3,4)5/h6-10,15-19,24H,11-14H2,1-5H3,(H,33,39)(H,34,37)(H,35,38) |
| InChIKey | UJARXACZSNUKGF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|