C19H22IN3O2 — CID 118057729
[1-[3-(3,5-dimethylphenyl)-5-iodo-4-pyridinyl]piperidin-4-yl]carbamic acid (PubChem CID 118057729) has the molecular formula C19H22IN3O2 and a molecular weight of 451.31 g/mol. Its IUPAC name is [1-[3-(3,5-dimethylphenyl)-5-iodo-4-pyridinyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[3-(3,5-dimethylphenyl)-5-iodo-4-pyridinyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 118057729 |
| Molecular Formula | C19H22IN3O2 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | [1-[3-(3,5-dimethylphenyl)-5-iodo-4-pyridinyl]piperidin-4-yl]carbamic acid |
| SMILES | Cc1cc(C)cc(-c2cncc(I)c2N2CCC(NC(=O)O)CC2)c1 |
| InChI | InChI=1S/C19H22IN3O2/c1-12-7-13(2)9-14(8-12)16-10-21-11-17(20)18(16)23-5-3-15(4-6-23)22-19(24)25/h7-11,15,22H,3-6H2,1-2H3,(H,24,25) |
| InChIKey | QRFBULHBUIZUBE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|