C10H14ClN5O2 — CID 166708160
[1-(3-amino-6-chloropyridazin-4-yl)piperidin-4-yl]carbamic acid (PubChem CID 166708160) has the molecular formula C10H14ClN5O2 and a molecular weight of 271.71 g/mol. Its IUPAC name is [1-(3-amino-6-chloropyridazin-4-yl)piperidin-4-yl]carbamic acid.
| Compound Name | [1-(3-amino-6-chloropyridazin-4-yl)piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 166708160 |
| Molecular Formula | C10H14ClN5O2 |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | [1-(3-amino-6-chloropyridazin-4-yl)piperidin-4-yl]carbamic acid |
| SMILES | Nc1nnc(Cl)cc1N1CCC(NC(=O)O)CC1 |
| InChI | InChI=1S/C10H14ClN5O2/c11-8-5-7(9(12)15-14-8)16-3-1-6(2-4-16)13-10(17)18/h5-6,13H,1-4H2,(H2,12,15)(H,17,18) |
| InChIKey | ARZIPMFPWKBADN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |