C21H38N4O2 — CID 140684647
1-[(2S)-2-methyl-4-[(6-morpholin-4-ylpiperidin-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 140684647) has the molecular formula C21H38N4O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 1-[(2S)-2-methyl-4-[(6-morpholin-4-ylpiperidin-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-methyl-4-[(6-morpholin-4-ylpiperidin-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 140684647 |
| Molecular Formula | C21H38N4O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | 1-[(2S)-2-methyl-4-[(6-morpholin-4-ylpiperidin-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | CC(=O)N1C2CCCCC2N(CC2CCC(N3CCOCC3)NC2)C[C@@H]1C |
| InChI | InChI=1S/C21H38N4O2/c1-16-14-24(19-5-3-4-6-20(19)25(16)17(2)26)15-18-7-8-21(22-13-18)23-9-11-27-12-10-23/h16,18-22H,3-15H2,1-2H3/t16-,18?,19?,20?,21?/m0/s1 |
| InChIKey | CLBJBMKXZRIUDZ-DPYIETLKSA-N |
| XLogP | 1.51 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |