C19H32F2N4O2 — CID 177152032
9-(4,4-difluorocyclohexyl)-2,3-dimethyl-7-morpholin-4-yl-1,2,3,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrimidin-4-one (PubChem CID 177152032) has the molecular formula C19H32F2N4O2 and a molecular weight of 386.49 g/mol. Its IUPAC name is 9-(4,4-difluorocyclohexyl)-2,3-dimethyl-7-morpholin-4-yl-1,2,3,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrimidin-4-one.
| Compound Name | 9-(4,4-difluorocyclohexyl)-2,3-dimethyl-7-morpholin-4-yl-1,2,3,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 177152032 |
| Molecular Formula | C19H32F2N4O2 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 9-(4,4-difluorocyclohexyl)-2,3-dimethyl-7-morpholin-4-yl-1,2,3,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrimidin-4-one |
| SMILES | CC1NC2C(C3CCC(F)(F)CC3)NC(N3CCOCC3)CN2C(=O)C1C |
| InChI | InChI=1S/C19H32F2N4O2/c1-12-13(2)22-17-16(14-3-5-19(20,21)6-4-14)23-15(11-25(17)18(12)26)24-7-9-27-10-8-24/h12-17,22-23H,3-11H2,1-2H3 |
| InChIKey | DCYGKVANXOMYJJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |