C27H53F2N7O2 — CID 163567721
N-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-5-fluoropiperidin-3-yl]-2-(diaminomethyl)-3-[(5-ethyl-2-fluorooctyl)amino]butanamide (PubChem CID 163567721) has the molecular formula C27H53F2N7O2 and a molecular weight of 545.76 g/mol. Its IUPAC name is N-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-5-fluoropiperidin-3-yl]-2-(diaminomethyl)-3-[(5-ethyl-2-fluorooctyl)amino]butanamide.
| Compound Name | N-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-5-fluoropiperidin-3-yl]-2-(diaminomethyl)-3-[(5-ethyl-2-fluorooctyl)amino]butanamide |
|---|---|
| PubChem CID | 163567721 |
| Molecular Formula | C27H53F2N7O2 |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.42 |
| IUPAC Name | N-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-5-fluoropiperidin-3-yl]-2-(diaminomethyl)-3-[(5-ethyl-2-fluorooctyl)amino]butanamide |
| SMILES | CCCC(CC)CCC(F)CNC(C)C(C(=O)NC1CNCC(F)C1N1CCN2CCOC[C@H]2C1)C(N)N |
| InChI | InChI=1S/C27H53F2N7O2/c1-4-6-19(5-2)7-8-20(28)13-33-18(3)24(26(30)31)27(37)34-23-15-32-14-22(29)25(23)36-10-9-35-11-12-38-17-21(35)16-36/h18-26,32-33H,4-17,30-31H2,1-3H3,(H,34,37)/t18?,19?,20?,21-,22?,23?,24?,25?/m1/s1 |
| InChIKey | FWQAIHAHDXBXNN-HZOPGPIWSA-N |
| XLogP | 0.58 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|