C8H10N4 — CID 140686398
2-(5-methyl-1,3-dihydro-1,2,4-triazol-2-yl)pyridine (PubChem CID 140686398) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 2-(5-methyl-1,3-dihydro-1,2,4-triazol-2-yl)pyridine.
| Compound Name | 2-(5-methyl-1,3-dihydro-1,2,4-triazol-2-yl)pyridine |
|---|---|
| PubChem CID | 140686398 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-(5-methyl-1,3-dihydro-1,2,4-triazol-2-yl)pyridine |
| SMILES | CC1=NCN(c2ccccn2)N1 |
| InChI | InChI=1S/C8H10N4/c1-7-10-6-12(11-7)8-4-2-3-5-9-8/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | UBOLGKKISCZQLE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |