C28H38O4 — CID 140687759
[(2R,3R,4R,5S)-3,4-diphenoxy-5-undec-10-en-2-yloxolan-2-yl]methanol (PubChem CID 140687759) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-diphenoxy-5-undec-10-en-2-yloxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5S)-3,4-diphenoxy-5-undec-10-en-2-yloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 140687759 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-diphenoxy-5-undec-10-en-2-yloxolan-2-yl]methanol |
| SMILES | C=CCCCCCCCC(C)[C@@H]1O[C@H](CO)[C@@H](Oc2ccccc2)[C@@H]1Oc1ccccc1 |
| InChI | InChI=1S/C28H38O4/c1-3-4-5-6-7-8-11-16-22(2)26-28(31-24-19-14-10-15-20-24)27(25(21-29)32-26)30-23-17-12-9-13-18-23/h3,9-10,12-15,17-20,22,25-29H,1,4-8,11,16,21H2,2H3/t22?,25-,26+,27-,28-/m1/s1 |
| InChIKey | KNXYUOSLCZQFTO-FYWPAEFWSA-N |
| XLogP | 6.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|