C18H34O5 — CID 89467401
2-(dimethoxymethyl)-5-undec-10-enyloxolane-3,4-diol (PubChem CID 89467401) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-5-undec-10-enyloxolane-3,4-diol.
| Compound Name | 2-(dimethoxymethyl)-5-undec-10-enyloxolane-3,4-diol |
|---|---|
| PubChem CID | 89467401 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 2-(dimethoxymethyl)-5-undec-10-enyloxolane-3,4-diol |
| SMILES | C=CCCCCCCCCCC1OC(C(OC)OC)C(O)C1O |
| InChI | InChI=1S/C18H34O5/c1-4-5-6-7-8-9-10-11-12-13-14-15(19)16(20)17(23-14)18(21-2)22-3/h4,14-20H,1,5-13H2,2-3H3 |
| InChIKey | RKNXKTCCXMHJBA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|