C30H42O6 — CID 150771199
[(2R,3R,4R,5R)-3,4-bis(4-methoxyphenoxy)-5-undec-10-en-2-yloxolan-2-yl]methanol (PubChem CID 150771199) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis(4-methoxyphenoxy)-5-undec-10-en-2-yloxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis(4-methoxyphenoxy)-5-undec-10-en-2-yloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 150771199 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis(4-methoxyphenoxy)-5-undec-10-en-2-yloxolan-2-yl]methanol |
| SMILES | C=CCCCCCCCC(C)[C@H]1O[C@H](CO)[C@@H](Oc2ccc(OC)cc2)[C@@H]1Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H42O6/c1-5-6-7-8-9-10-11-12-22(2)28-30(35-26-19-15-24(33-4)16-20-26)29(27(21-31)36-28)34-25-17-13-23(32-3)14-18-25/h5,13-20,22,27-31H,1,6-12,21H2,2-4H3/t22?,27-,28-,29-,30-/m1/s1 |
| InChIKey | JZXBPKHJNNJYJS-CEZOAOSTSA-N |
| XLogP | 6.21 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|