C12H17N2O6+ — CID 140689272
1-[(4R,5S,6R,8R)-5-hydroxy-6-(hydroxymethyl)-1,7-dioxaspiro[3.4]octan-8-yl]-1-methylpyrimidin-1-ium-2,4-dione (PubChem CID 140689272) has the molecular formula C12H17N2O6+ and a molecular weight of 285.28 g/mol. Its IUPAC name is 1-[(4R,5S,6R,8R)-5-hydroxy-6-(hydroxymethyl)-1,7-dioxaspiro[3.4]octan-8-yl]-1-methylpyrimidin-1-ium-2,4-dione.
| Compound Name | 1-[(4R,5S,6R,8R)-5-hydroxy-6-(hydroxymethyl)-1,7-dioxaspiro[3.4]octan-8-yl]-1-methylpyrimidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 140689272 |
| Molecular Formula | C12H17N2O6+ |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[(4R,5S,6R,8R)-5-hydroxy-6-(hydroxymethyl)-1,7-dioxaspiro[3.4]octan-8-yl]-1-methylpyrimidin-1-ium-2,4-dione |
| SMILES | C[N+]1([C@@H]2O[C@H](CO)[C@H](O)[C@]23CCO3)C=CC(=O)NC1=O |
| InChI | InChI=1S/C12H16N2O6/c1-14(4-2-8(16)13-11(14)18)10-12(3-5-19-12)9(17)7(6-15)20-10/h2,4,7,9-10,15,17H,3,5-6H2,1H3/p+1/t7-,9+,10-,12-,14?/m1/s1 |
| InChIKey | GFWNCAHFHWVGRU-GPRNHDLUSA-O |
| XLogP | -1.57 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|