C35H42BN3O6 — CID 140689944
9H-fluoren-9-yl N-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]propan-2-yl]amino]butan-2-yl]carbamate (PubChem CID 140689944) has the molecular formula C35H42BN3O6 and a molecular weight of 611.55 g/mol. Its IUPAC name is 9H-fluoren-9-yl N-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]propan-2-yl]amino]butan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-yl N-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]propan-2-yl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140689944 |
| Molecular Formula | C35H42BN3O6 |
| Molecular Weight | 611.55 g/mol |
| Exact Mass | 611.32 |
| IUPAC Name | 9H-fluoren-9-yl N-methyl-N-[(2S)-3-methyl-1-oxo-1-[[(2S)-1-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]propan-2-yl]amino]butan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](C)C(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)N(C)C(=O)OC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H42BN3O6/c1-21(2)29(39(8)33(42)43-30-27-15-11-9-13-25(27)26-14-10-12-16-28(26)30)32(41)37-22(3)31(40)38-24-19-17-23(18-20-24)36-44-34(4,5)35(6,7)45-36/h9-22,29-30H,1-8H3,(H,37,41)(H,38,40)/t22-,29-/m0/s1 |
| InChIKey | CHHNJQKCMJIAHL-ZTOMLWHTSA-N |
| XLogP | 5.29 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|