C38H49BN2O6 — CID 163550755
(9a-methyl-4a,9-dihydrofluoren-9-yl)methyl (4S)-5-methyl-4-[[(2S)-1-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]propan-2-yl]carbamoyl]hexanoate (PubChem CID 163550755) has the molecular formula C38H49BN2O6 and a molecular weight of 640.63 g/mol. Its IUPAC name is (9a-methyl-4a,9-dihydrofluoren-9-yl)methyl (4S)-5-methyl-4-[[(2S)-1-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]propan-2-yl]carbamoyl]hexanoate.
| Compound Name | (9a-methyl-4a,9-dihydrofluoren-9-yl)methyl (4S)-5-methyl-4-[[(2S)-1-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]propan-2-yl]carbamoyl]hexanoate |
|---|---|
| PubChem CID | 163550755 |
| Molecular Formula | C38H49BN2O6 |
| Molecular Weight | 640.63 g/mol |
| Exact Mass | 640.37 |
| IUPAC Name | (9a-methyl-4a,9-dihydrofluoren-9-yl)methyl (4S)-5-methyl-4-[[(2S)-1-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]propan-2-yl]carbamoyl]hexanoate |
| SMILES | CC(C)[C@H](CCC(=O)OCC1c2ccccc2C2C=CC=CC21C)C(=O)N[C@@H](C)C(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C38H49BN2O6/c1-24(2)28(20-21-33(42)45-23-32-30-14-10-9-13-29(30)31-15-11-12-22-38(31,32)8)35(44)40-25(3)34(43)41-27-18-16-26(17-19-27)39-46-36(4,5)37(6,7)47-39/h9-19,22,24-25,28,31-32H,20-21,23H2,1-8H3,(H,40,44)(H,41,43)/t25-,28-,31?,32?,38?/m0/s1 |
| InChIKey | FIVVFWHPIVDXGN-AQPGZWGVSA-N |
| XLogP | 6.04 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|