C17H19F3N4O3 — CID 14068995
4,5-dimethoxy-2-[1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]ethylideneamino]benzonitrile (PubChem CID 14068995) has the molecular formula C17H19F3N4O3 and a molecular weight of 384.36 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]ethylideneamino]benzonitrile.
| Compound Name | 4,5-dimethoxy-2-[1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]ethylideneamino]benzonitrile |
|---|---|
| PubChem CID | 14068995 |
| Molecular Formula | C17H19F3N4O3 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4,5-dimethoxy-2-[1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]ethylideneamino]benzonitrile |
| SMILES | COc1cc(C#N)c(/N=C(\C)N2CCN(C(=O)C(F)(F)F)CC2)cc1OC |
| InChI | InChI=1S/C17H19F3N4O3/c1-11(23-4-6-24(7-5-23)16(25)17(18,19)20)22-13-9-15(27-3)14(26-2)8-12(13)10-21/h8-9H,4-7H2,1-3H3/b22-11+ |
| InChIKey | XNWOVVJUOBYXEN-SSDVNMTOSA-N |
| XLogP | 2.33 |
| TPSA | 78.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|