C19H25N3O5S — CID 88776830
ethyl 1-[N-(2-cyano-4,5-dimethoxyphenyl)-C-methoxycarbonimidoyl]sulfanylpiperidine-4-carboxylate (PubChem CID 88776830) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is ethyl 1-[N-(2-cyano-4,5-dimethoxyphenyl)-C-methoxycarbonimidoyl]sulfanylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-(2-cyano-4,5-dimethoxyphenyl)-C-methoxycarbonimidoyl]sulfanylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 88776830 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | ethyl 1-[N-(2-cyano-4,5-dimethoxyphenyl)-C-methoxycarbonimidoyl]sulfanylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S/C(=N/c2cc(OC)c(OC)cc2C#N)OC)CC1 |
| InChI | InChI=1S/C19H25N3O5S/c1-5-27-18(23)13-6-8-22(9-7-13)28-19(26-4)21-15-11-17(25-3)16(24-2)10-14(15)12-20/h10-11,13H,5-9H2,1-4H3/b21-19+ |
| InChIKey | VNSNMCQOZBHCEG-XUTLUUPISA-N |
| XLogP | 3.13 |
| TPSA | 93.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|