C18H23N3O3S — CID 70596494
methyl 4-acetyl-N-(2-cyano-4,5-dimethoxyphenyl)piperidine-1-carboximidothioate (PubChem CID 70596494) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is methyl 4-acetyl-N-(2-cyano-4,5-dimethoxyphenyl)piperidine-1-carboximidothioate.
| Compound Name | methyl 4-acetyl-N-(2-cyano-4,5-dimethoxyphenyl)piperidine-1-carboximidothioate |
|---|---|
| PubChem CID | 70596494 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | methyl 4-acetyl-N-(2-cyano-4,5-dimethoxyphenyl)piperidine-1-carboximidothioate |
| SMILES | COc1cc(C#N)c(/N=C(\SC)N2CCC(C(C)=O)CC2)cc1OC |
| InChI | InChI=1S/C18H23N3O3S/c1-12(22)13-5-7-21(8-6-13)18(25-4)20-15-10-17(24-3)16(23-2)9-14(15)11-19/h9-10,13H,5-8H2,1-4H3/b20-18- |
| InChIKey | HRCPOXADJAVZGT-ZZEZOPTASA-N |
| XLogP | 3.23 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|