C16H10F2N2O2 — CID 140692175
2-[3,5-difluoro-6-(2-hydroxyphenyl)pyrazin-2-yl]phenol (PubChem CID 140692175) has the molecular formula C16H10F2N2O2 and a molecular weight of 300.26 g/mol. Its IUPAC name is 2-[3,5-difluoro-6-(2-hydroxyphenyl)pyrazin-2-yl]phenol.
| Compound Name | 2-[3,5-difluoro-6-(2-hydroxyphenyl)pyrazin-2-yl]phenol |
|---|---|
| PubChem CID | 140692175 |
| Molecular Formula | C16H10F2N2O2 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-[3,5-difluoro-6-(2-hydroxyphenyl)pyrazin-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc(-c2ccccc2O)c(F)nc1F |
| InChI | InChI=1S/C16H10F2N2O2/c17-15-13(9-5-1-3-7-11(9)21)19-14(16(18)20-15)10-6-2-4-8-12(10)22/h1-8,21-22H |
| InChIKey | PJDYYRFTRWWLOM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |