C28H29N5Si — CID 140693771
trimethyl-[4-[2-(3-phenyl-2H-imidazol-1-yl)ethyl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaen-14-yl]silane (PubChem CID 140693771) has the molecular formula C28H29N5Si and a molecular weight of 463.66 g/mol. Its IUPAC name is trimethyl-[4-[2-(3-phenyl-2H-imidazol-1-yl)ethyl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaen-14-yl]silane.
| Compound Name | trimethyl-[4-[2-(3-phenyl-2H-imidazol-1-yl)ethyl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaen-14-yl]silane |
|---|---|
| PubChem CID | 140693771 |
| Molecular Formula | C28H29N5Si |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | trimethyl-[4-[2-(3-phenyl-2H-imidazol-1-yl)ethyl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaen-14-yl]silane |
| SMILES | C[Si](C)(C)c1cccc2c1c1ncccc1c1nc(CCN3C=CN(c4ccccc4)C3)cn21 |
| InChI | InChI=1S/C28H29N5Si/c1-34(2,3)25-13-7-12-24-26(25)27-23(11-8-15-29-27)28-30-21(19-33(24)28)14-16-31-17-18-32(20-31)22-9-5-4-6-10-22/h4-13,15,17-19H,14,16,20H2,1-3H3 |
| InChIKey | JVYRSHXSFHMQKC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|