C13H18N4OS — CID 140695153
[[1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrazol-3-yl]amino]methanethiol (PubChem CID 140695153) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is [[1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrazol-3-yl]amino]methanethiol.
| Compound Name | [[1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrazol-3-yl]amino]methanethiol |
|---|---|
| PubChem CID | 140695153 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [[1-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]pyrazol-3-yl]amino]methanethiol |
| SMILES | COc1c(C)cnc(Cn2ccc(NCS)n2)c1C |
| InChI | InChI=1S/C13H18N4OS/c1-9-6-14-11(10(2)13(9)18-3)7-17-5-4-12(16-17)15-8-19/h4-6,19H,7-8H2,1-3H3,(H,15,16) |
| InChIKey | LFVMMIIMOWTMRR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|