C13H17BrN4O — CID 81448896
2-[[4-(1-bromoethyl)triazol-1-yl]methyl]-4-methoxy-3,5-dimethylpyridine (PubChem CID 81448896) has the molecular formula C13H17BrN4O and a molecular weight of 325.21 g/mol. Its IUPAC name is 2-[[4-(1-bromoethyl)triazol-1-yl]methyl]-4-methoxy-3,5-dimethylpyridine.
| Compound Name | 2-[[4-(1-bromoethyl)triazol-1-yl]methyl]-4-methoxy-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 81448896 |
| Molecular Formula | C13H17BrN4O |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-[[4-(1-bromoethyl)triazol-1-yl]methyl]-4-methoxy-3,5-dimethylpyridine |
| SMILES | COc1c(C)cnc(Cn2cc(C(C)Br)nn2)c1C |
| InChI | InChI=1S/C13H17BrN4O/c1-8-5-15-11(9(2)13(8)19-4)6-18-7-12(10(3)14)16-17-18/h5,7,10H,6H2,1-4H3 |
| InChIKey | FNVVPAJYABNUCY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|