C31H24N4O8 — CID 140696433
3-methyl-1-[3-(3-methyl-2,5-dioxopyrrol-1-yl)-5-[4-(2-oxochromene-3-carbonyl)piperazine-1-carbonyl]phenyl]pyrrole-2,5-dione (PubChem CID 140696433) has the molecular formula C31H24N4O8 and a molecular weight of 580.55 g/mol. Its IUPAC name is 3-methyl-1-[3-(3-methyl-2,5-dioxopyrrol-1-yl)-5-[4-(2-oxochromene-3-carbonyl)piperazine-1-carbonyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[3-(3-methyl-2,5-dioxopyrrol-1-yl)-5-[4-(2-oxochromene-3-carbonyl)piperazine-1-carbonyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 140696433 |
| Molecular Formula | C31H24N4O8 |
| Molecular Weight | 580.55 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 3-methyl-1-[3-(3-methyl-2,5-dioxopyrrol-1-yl)-5-[4-(2-oxochromene-3-carbonyl)piperazine-1-carbonyl]phenyl]pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(c2cc(C(=O)N3CCN(C(=O)c4cc5ccccc5oc4=O)CC3)cc(N3C(=O)C=C(C)C3=O)c2)C1=O |
| InChI | InChI=1S/C31H24N4O8/c1-17-11-25(36)34(27(17)38)21-13-20(14-22(16-21)35-26(37)12-18(2)28(35)39)29(40)32-7-9-33(10-8-32)30(41)23-15-19-5-3-4-6-24(19)43-31(23)42/h3-6,11-16H,7-10H2,1-2H3 |
| InChIKey | ISWYGAUBZBCULN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 145.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|