C26H27F4O5S- — CID 140699189
4-(4-acetyl-2,6-dicyclohexylphenoxy)-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 140699189) has the molecular formula C26H27F4O5S- and a molecular weight of 527.56 g/mol. Its IUPAC name is 4-(4-acetyl-2,6-dicyclohexylphenoxy)-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-(4-acetyl-2,6-dicyclohexylphenoxy)-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 140699189 |
| Molecular Formula | C26H27F4O5S- |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 4-(4-acetyl-2,6-dicyclohexylphenoxy)-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | CC(=O)c1cc(C2CCCCC2)c(Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C26H28F4O5S/c1-14(31)17-12-18(15-8-4-2-5-9-15)24(19(13-17)16-10-6-3-7-11-16)35-25-20(27)22(29)26(36(32,33)34)23(30)21(25)28/h12-13,15-16H,2-11H2,1H3,(H,32,33,34)/p-1 |
| InChIKey | JJAIWQXNHITPCT-UHFFFAOYSA-M |
| XLogP | 7.24 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|