C19H19NO2 — CID 140700259
3-[(2,4-dimethylanilino)-hydroxymethyl]naphthalen-2-ol (PubChem CID 140700259) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[(2,4-dimethylanilino)-hydroxymethyl]naphthalen-2-ol.
| Compound Name | 3-[(2,4-dimethylanilino)-hydroxymethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 140700259 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-[(2,4-dimethylanilino)-hydroxymethyl]naphthalen-2-ol |
| SMILES | Cc1ccc(NC(O)c2cc3ccccc3cc2O)c(C)c1 |
| InChI | InChI=1S/C19H19NO2/c1-12-7-8-17(13(2)9-12)20-19(22)16-10-14-5-3-4-6-15(14)11-18(16)21/h3-11,19-22H,1-2H3 |
| InChIKey | CHEPBSBPWDZKRQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|