C38H36MnN2O4+2 — CID 3879484
bis([(2,4-dimethylanilino)-(3-hydroxynaphthalen-2-yl)methylidene]oxidanium);manganese (PubChem CID 3879484) has the molecular formula C38H36MnN2O4+2 and a molecular weight of 639.65 g/mol. Its IUPAC name is bis([(2,4-dimethylanilino)-(3-hydroxynaphthalen-2-yl)methylidene]oxidanium);manganese.
| Compound Name | bis([(2,4-dimethylanilino)-(3-hydroxynaphthalen-2-yl)methylidene]oxidanium);manganese |
|---|---|
| PubChem CID | 3879484 |
| Molecular Formula | C38H36MnN2O4+2 |
| Molecular Weight | 639.65 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | bis([(2,4-dimethylanilino)-(3-hydroxynaphthalen-2-yl)methylidene]oxidanium);manganese |
| SMILES | [H]/[O+]=C(\Nc1ccc(C)cc1C)c1cc2ccccc2cc1O.[H]/[O+]=C(\Nc1ccc(C)cc1C)c1cc2ccccc2cc1O.[Mn] |
| InChI | InChI=1S/2C19H17NO2.Mn/c2*1-12-7-8-17(13(2)9-12)20-19(22)16-10-14-5-3-4-6-15(14)11-18(16)21;/h2*3-11,21H,1-2H3,(H,20,22);/p+2 |
| InChIKey | CYPDDSNJBQWEKK-UHFFFAOYSA-P |
| XLogP | 8.25 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.65 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|