C27H37N3O5 — CID 140700315
benzyl N-[1-[(3-methylphenyl)methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate (PubChem CID 140700315) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is benzyl N-[1-[(3-methylphenyl)methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(3-methylphenyl)methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 140700315 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | benzyl N-[1-[(3-methylphenyl)methylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate |
| SMILES | CCCCC(NC(=O)OCc1ccccc1)(NC(=O)OC(C)(C)C)C(=O)NCc1cccc(C)c1 |
| InChI | InChI=1S/C27H37N3O5/c1-6-7-16-27(30-25(33)35-26(3,4)5,23(31)28-18-22-15-11-12-20(2)17-22)29-24(32)34-19-21-13-9-8-10-14-21/h8-15,17H,6-7,16,18-19H2,1-5H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | FCSMVPYQZCGPPM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|