C22H32N2O7 — CID 86648876
benzyl 2,2-bis[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 86648876) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is benzyl 2,2-bis[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | benzyl 2,2-bis[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 86648876 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | benzyl 2,2-bis[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)NC(CCC=O)(NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H32N2O7/c1-20(2,3)30-18(27)23-22(13-10-14-25,24-19(28)31-21(4,5)6)17(26)29-15-16-11-8-7-9-12-16/h7-9,11-12,14H,10,13,15H2,1-6H3,(H,23,27)(H,24,28) |
| InChIKey | QSROPABYBYYNRL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|