C16H20N2O5 — CID 57319144
tert-butyl (2R)-2-isocyanato-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 57319144) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is tert-butyl (2R)-2-isocyanato-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | tert-butyl (2R)-2-isocyanato-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 57319144 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | tert-butyl (2R)-2-isocyanato-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@@](C)(N=C=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H20N2O5/c1-15(2,3)23-13(20)16(4,17-11-19)18-14(21)22-10-12-8-6-5-7-9-12/h5-9H,10H2,1-4H3,(H,18,21)/t16-/m0/s1 |
| InChIKey | BWZFTHFYSIMRNG-INIZCTEOSA-N |
| XLogP | 2.31 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|