C22H32N2O7 — CID 142841446
tert-butyl (2S,4R)-4-hydroxy-2-isocyanato-2-[(2-methylpropan-2-yl)oxy]-5-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 142841446) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-hydroxy-2-isocyanato-2-[(2-methylpropan-2-yl)oxy]-5-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | tert-butyl (2S,4R)-4-hydroxy-2-isocyanato-2-[(2-methylpropan-2-yl)oxy]-5-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 142841446 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | tert-butyl (2S,4R)-4-hydroxy-2-isocyanato-2-[(2-methylpropan-2-yl)oxy]-5-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC(C)(C)OC(=O)[C@@](C[C@@H](O)CNC(=O)OCc1ccccc1)(N=C=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N2O7/c1-20(2,3)30-18(27)22(24-15-25,31-21(4,5)6)12-17(26)13-23-19(28)29-14-16-10-8-7-9-11-16/h7-11,17,26H,12-14H2,1-6H3,(H,23,28)/t17-,22+/m1/s1 |
| InChIKey | ZIUDDBWHGBWHAI-VGSWGCGISA-N |
| XLogP | 2.85 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|