C30H39N5 — CID 140701021
N-(1-aminoethylidene)-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridine-2-carboximidamide (PubChem CID 140701021) has the molecular formula C30H39N5 and a molecular weight of 469.68 g/mol. Its IUPAC name is N-(1-aminoethylidene)-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridine-2-carboximidamide.
| Compound Name | N-(1-aminoethylidene)-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 140701021 |
| Molecular Formula | C30H39N5 |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | N-(1-aminoethylidene)-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N=C(/C)N)c1cc(N(c2ccc(CCCCC)cc2)c2ccc(CCCCC)cc2)ccn1 |
| InChI | InChI=1S/C30H39N5/c1-4-6-8-10-24-12-16-26(17-13-24)35(27-18-14-25(15-19-27)11-9-7-5-2)28-20-21-33-29(22-28)30(32)34-23(3)31/h12-22H,4-11H2,1-3H3,(H3,31,32,34) |
| InChIKey | BWFIQFYUSDHTIT-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 78.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|