C18H26F3N3 — CID 140687388
1,1,1-trifluoro-4-imino-4-(4-nonyl-2-pyridinyl)but-2-en-2-amine (PubChem CID 140687388) has the molecular formula C18H26F3N3 and a molecular weight of 341.42 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-imino-4-(4-nonyl-2-pyridinyl)but-2-en-2-amine.
| Compound Name | 1,1,1-trifluoro-4-imino-4-(4-nonyl-2-pyridinyl)but-2-en-2-amine |
|---|---|
| PubChem CID | 140687388 |
| Molecular Formula | C18H26F3N3 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1,1,1-trifluoro-4-imino-4-(4-nonyl-2-pyridinyl)but-2-en-2-amine |
| SMILES | [H]/N=C(/C=C(N)C(F)(F)F)c1cc(CCCCCCCCC)ccn1 |
| InChI | InChI=1S/C18H26F3N3/c1-2-3-4-5-6-7-8-9-14-10-11-24-16(12-14)15(22)13-17(23)18(19,20)21/h10-13,22H,2-9,23H2,1H3/b17-13?,22-15- |
| InChIKey | CEMFBWNIYOHHJM-CWCYPAJLSA-N |
| XLogP | 5.15 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|