C21H28FN3S — CID 145155858
4-fluoro-1-[5-(5-hexylthiophen-2-yl)-2-pyridinyl]-1-imino-4-methylpent-2-en-3-amine (PubChem CID 145155858) has the molecular formula C21H28FN3S and a molecular weight of 373.54 g/mol. Its IUPAC name is 4-fluoro-1-[5-(5-hexylthiophen-2-yl)-2-pyridinyl]-1-imino-4-methylpent-2-en-3-amine.
| Compound Name | 4-fluoro-1-[5-(5-hexylthiophen-2-yl)-2-pyridinyl]-1-imino-4-methylpent-2-en-3-amine |
|---|---|
| PubChem CID | 145155858 |
| Molecular Formula | C21H28FN3S |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-fluoro-1-[5-(5-hexylthiophen-2-yl)-2-pyridinyl]-1-imino-4-methylpent-2-en-3-amine |
| SMILES | [H]/N=C(/C=C(N)C(C)(C)F)c1ccc(-c2ccc(CCCCCC)s2)cn1 |
| InChI | InChI=1S/C21H28FN3S/c1-4-5-6-7-8-16-10-12-19(26-16)15-9-11-18(25-14-15)17(23)13-20(24)21(2,3)22/h9-14,23H,4-8,24H2,1-3H3/b20-13?,23-17- |
| InChIKey | ASQPQRKXEBDDQD-QHHBBRJFSA-N |
| XLogP | 5.89 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|