C22H18F5N3S — CID 145155864
(Z)-1-[5-(5-butylthiophen-2-yl)-2-pyridinyl]-3-imino-3-(2,3,4,5,6-pentafluorophenyl)prop-1-en-1-amine (PubChem CID 145155864) has the molecular formula C22H18F5N3S and a molecular weight of 451.46 g/mol. Its IUPAC name is (Z)-1-[5-(5-butylthiophen-2-yl)-2-pyridinyl]-3-imino-3-(2,3,4,5,6-pentafluorophenyl)prop-1-en-1-amine.
| Compound Name | (Z)-1-[5-(5-butylthiophen-2-yl)-2-pyridinyl]-3-imino-3-(2,3,4,5,6-pentafluorophenyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 145155864 |
| Molecular Formula | C22H18F5N3S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | (Z)-1-[5-(5-butylthiophen-2-yl)-2-pyridinyl]-3-imino-3-(2,3,4,5,6-pentafluorophenyl)prop-1-en-1-amine |
| SMILES | [H]/N=C(\C=C(/N)c1ccc(-c2ccc(CCCC)s2)cn1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H18F5N3S/c1-2-3-4-12-6-8-16(31-12)11-5-7-15(30-10-11)13(28)9-14(29)17-18(23)20(25)22(27)21(26)19(17)24/h5-10,29H,2-4,28H2,1H3/b13-9-,29-14+ |
| InChIKey | IJEZRBWREXMJNR-BDZUGSQHSA-N |
| XLogP | 6.22 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|