C36H42F6N6 — CID 161469935
[(Z)-1-[6-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-1-methyl-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridin-1-ium-2-yl]-4,4,4-trifluoro-3-iminobut-1-enyl]azanide (PubChem CID 161469935) has the molecular formula C36H42F6N6 and a molecular weight of 672.76 g/mol. Its IUPAC name is [(Z)-1-[6-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-1-methyl-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridin-1-ium-2-yl]-4,4,4-trifluoro-3-iminobut-1-enyl]azanide.
| Compound Name | [(Z)-1-[6-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-1-methyl-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridin-1-ium-2-yl]-4,4,4-trifluoro-3-iminobut-1-enyl]azanide |
|---|---|
| PubChem CID | 161469935 |
| Molecular Formula | C36H42F6N6 |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | [(Z)-1-[6-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-1-methyl-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridin-1-ium-2-yl]-4,4,4-trifluoro-3-iminobut-1-enyl]azanide |
| SMILES | [H]/N=C(/C=C(\[NH-])c1cc(N(c2ccc(CCCCC)cc2)c2ccc(CCCCC)cc2)cc(/C(C=C(N)C(F)(F)F)=N/[H])[n+]1C)C(F)(F)F |
| InChI | InChI=1S/C36H42F6N6/c1-4-6-8-10-24-12-16-26(17-13-24)48(27-18-14-25(15-19-27)11-9-7-5-2)28-20-31(29(43)22-33(45)35(37,38)39)47(3)32(21-28)30(44)23-34(46)36(40,41)42/h12-23,43-45H,4-11,46H2,1-3H3/b29-22-,34-23?,44-30+,45-33- |
| InChIKey | ZAUULSZALFJQIG-IRXUCJRPSA-N |
| XLogP | 10.19 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|