C20H24F6N6O — CID 161148396
2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-N,N-dimethyl-4-pentyl-6-[(Z)-4,4,4-trifluoro-3-imino-1-nitrosobut-1-enyl]pyridin-3-amine (PubChem CID 161148396) has the molecular formula C20H24F6N6O and a molecular weight of 478.44 g/mol. Its IUPAC name is 2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-N,N-dimethyl-4-pentyl-6-[(Z)-4,4,4-trifluoro-3-imino-1-nitrosobut-1-enyl]pyridin-3-amine.
| Compound Name | 2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-N,N-dimethyl-4-pentyl-6-[(Z)-4,4,4-trifluoro-3-imino-1-nitrosobut-1-enyl]pyridin-3-amine |
|---|---|
| PubChem CID | 161148396 |
| Molecular Formula | C20H24F6N6O |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-N,N-dimethyl-4-pentyl-6-[(Z)-4,4,4-trifluoro-3-imino-1-nitrosobut-1-enyl]pyridin-3-amine |
| SMILES | [H]/N=C(/C=C(\N=O)c1cc(CCCCC)c(N(C)C)c(/C(C=C(N)C(F)(F)F)=N/[H])n1)C(F)(F)F |
| InChI | InChI=1S/C20H24F6N6O/c1-4-5-6-7-11-8-13(14(31-33)10-16(29)20(24,25)26)30-17(18(11)32(2)3)12(27)9-15(28)19(21,22)23/h8-10,27,29H,4-7,28H2,1-3H3/b14-10-,15-9?,27-12+,29-16- |
| InChIKey | XBJIZRMKBQYXSO-QDBICFBMSA-N |
| XLogP | 5.34 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|