C33H25F3N4 — CID 140701134
N-[4-[2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-4-pyridinyl]phenyl]-N,4-diphenylaniline (PubChem CID 140701134) has the molecular formula C33H25F3N4 and a molecular weight of 534.59 g/mol. Its IUPAC name is N-[4-[2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-4-pyridinyl]phenyl]-N,4-diphenylaniline.
| Compound Name | N-[4-[2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-4-pyridinyl]phenyl]-N,4-diphenylaniline |
|---|---|
| PubChem CID | 140701134 |
| Molecular Formula | C33H25F3N4 |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | N-[4-[2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-4-pyridinyl]phenyl]-N,4-diphenylaniline |
| SMILES | [H]/N=C(\C=C(N)C(F)(F)F)c1cc(-c2ccc(N(c3ccccc3)c3ccc(-c4ccccc4)cc3)cc2)ccn1 |
| InChI | InChI=1S/C33H25F3N4/c34-33(35,36)32(38)22-30(37)31-21-26(19-20-39-31)25-13-17-29(18-14-25)40(27-9-5-2-6-10-27)28-15-11-24(12-16-28)23-7-3-1-4-8-23/h1-22,37H,38H2/b32-22?,37-30+ |
| InChIKey | FGQJEOMVALODRB-OKHMEEBSSA-N |
| XLogP | 8.66 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|