C21H17F3N4 — CID 140701094
2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-N,N-diphenylpyridin-4-amine (PubChem CID 140701094) has the molecular formula C21H17F3N4 and a molecular weight of 382.39 g/mol. Its IUPAC name is 2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-N,N-diphenylpyridin-4-amine.
| Compound Name | 2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-N,N-diphenylpyridin-4-amine |
|---|---|
| PubChem CID | 140701094 |
| Molecular Formula | C21H17F3N4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-N,N-diphenylpyridin-4-amine |
| SMILES | [H]/N=C(\C=C(N)C(F)(F)F)c1cc(N(c2ccccc2)c2ccccc2)ccn1 |
| InChI | InChI=1S/C21H17F3N4/c22-21(23,24)20(26)14-18(25)19-13-17(11-12-27-19)28(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,25H,26H2/b20-14?,25-18+ |
| InChIKey | LONBOEZKJBQDHJ-RLAVRWMZSA-N |
| XLogP | 5.32 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|