C19H22F3N3S — CID 153435358
(Z)-4,4,4-trifluoro-1-[4-(3-hexylthiophen-2-yl)-2-pyridinyl]-3-iminobut-1-en-1-amine (PubChem CID 153435358) has the molecular formula C19H22F3N3S and a molecular weight of 381.47 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-1-[4-(3-hexylthiophen-2-yl)-2-pyridinyl]-3-iminobut-1-en-1-amine.
| Compound Name | (Z)-4,4,4-trifluoro-1-[4-(3-hexylthiophen-2-yl)-2-pyridinyl]-3-iminobut-1-en-1-amine |
|---|---|
| PubChem CID | 153435358 |
| Molecular Formula | C19H22F3N3S |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (Z)-4,4,4-trifluoro-1-[4-(3-hexylthiophen-2-yl)-2-pyridinyl]-3-iminobut-1-en-1-amine |
| SMILES | [H]/N=C(/C=C(\N)c1cc(-c2sccc2CCCCCC)ccn1)C(F)(F)F |
| InChI | InChI=1S/C19H22F3N3S/c1-2-3-4-5-6-13-8-10-26-18(13)14-7-9-25-16(11-14)15(23)12-17(24)19(20,21)22/h7-12,24H,2-6,23H2,1H3/b15-12-,24-17- |
| InChIKey | NWDOQUWDISEHQI-XWUHJDKXSA-N |
| XLogP | 5.81 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|