C55H62F3N5 — CID 140701017
5-[6-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-3-pyridinyl]-1-N,1-N,3-N,3-N-tetrakis(4-tert-butylphenyl)benzene-1,3-diamine (PubChem CID 140701017) has the molecular formula C55H62F3N5 and a molecular weight of 850.13 g/mol. Its IUPAC name is 5-[6-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-3-pyridinyl]-1-N,1-N,3-N,3-N-tetrakis(4-tert-butylphenyl)benzene-1,3-diamine.
| Compound Name | 5-[6-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-3-pyridinyl]-1-N,1-N,3-N,3-N-tetrakis(4-tert-butylphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 140701017 |
| Molecular Formula | C55H62F3N5 |
| Molecular Weight | 850.13 g/mol |
| Exact Mass | 849.50 |
| IUPAC Name | 5-[6-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-3-pyridinyl]-1-N,1-N,3-N,3-N-tetrakis(4-tert-butylphenyl)benzene-1,3-diamine |
| SMILES | [H]/N=C(/C=C(\N)c1ccc(-c2cc(N(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)cc(N(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)c2)cn1)C(F)(F)F |
| InChI | InChI=1S/C55H62F3N5/c1-51(2,3)38-14-22-42(23-15-38)62(43-24-16-39(17-25-43)52(4,5)6)46-31-37(36-13-30-49(61-35-36)48(59)34-50(60)55(56,57)58)32-47(33-46)63(44-26-18-40(19-27-44)53(7,8)9)45-28-20-41(21-29-45)54(10,11)12/h13-35,60H,59H2,1-12H3/b48-34-,60-50- |
| InChIKey | PUMJDNGHSLTFLD-FGLOWYTGSA-N |
| XLogP | 15.76 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.13 |
| LogP ≤ 5 | 15.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|