C32H39F3N4 — CID 157288797
[(Z)-4,4,4-trifluoro-3-imino-1-[1-methyl-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridin-1-ium-2-yl]but-1-enyl]azanide (PubChem CID 157288797) has the molecular formula C32H39F3N4 and a molecular weight of 536.69 g/mol. Its IUPAC name is [(Z)-4,4,4-trifluoro-3-imino-1-[1-methyl-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridin-1-ium-2-yl]but-1-enyl]azanide.
| Compound Name | [(Z)-4,4,4-trifluoro-3-imino-1-[1-methyl-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridin-1-ium-2-yl]but-1-enyl]azanide |
|---|---|
| PubChem CID | 157288797 |
| Molecular Formula | C32H39F3N4 |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | [(Z)-4,4,4-trifluoro-3-imino-1-[1-methyl-4-(4-pentyl-N-(4-pentylphenyl)anilino)pyridin-1-ium-2-yl]but-1-enyl]azanide |
| SMILES | [H]/N=C(/C=C(\[NH-])c1cc(N(c2ccc(CCCCC)cc2)c2ccc(CCCCC)cc2)cc[n+]1C)C(F)(F)F |
| InChI | InChI=1S/C32H39F3N4/c1-4-6-8-10-24-12-16-26(17-13-24)39(27-18-14-25(15-19-27)11-9-7-5-2)28-20-21-38(3)30(22-28)29(36)23-31(37)32(33,34)35/h12-23,36-37H,4-11H2,1-3H3/b29-23-,37-31- |
| InChIKey | VXMJNVHRXCQOMC-XCYLVEDFSA-N |
| XLogP | 9.42 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|