C26H28BClNO3 — CID 140701246
CID 140701246 (PubChem CID 140701246) has the molecular formula C26H28BClNO3 and a molecular weight of 448.78 g/mol.
| Compound Name | CID 140701246 |
|---|---|
| PubChem CID | 140701246 |
| Molecular Formula | C26H28BClNO3 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | — |
| SMILES | O=C1CC/C=C/C[C@@H](CC(=O)NCc2ccc(Cl)cc2)C(=O)[B]CC(c2ccccc2)C1 |
| InChI | InChI=1S/C26H28BClNO3/c28-23-13-11-19(12-14-23)18-29-25(31)16-21-9-5-2-6-10-24(30)15-22(17-27-26(21)32)20-7-3-1-4-8-20/h1-5,7-8,11-14,21-22H,6,9-10,15-18H2,(H,29,31)/b5-2+/t21-,22?/m0/s1 |
| InChIKey | RWTHFJWGIZHNEY-RZHVXLNNSA-N |
| XLogP | 5.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|