C26H29ClN2O5 — CID 123410739
N-[(4-chlorophenyl)methyl]-2-[(3R,11S)-3-(2-methoxyphenyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetamide (PubChem CID 123410739) has the molecular formula C26H29ClN2O5 and a molecular weight of 484.98 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(3R,11S)-3-(2-methoxyphenyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(3R,11S)-3-(2-methoxyphenyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetamide |
|---|---|
| PubChem CID | 123410739 |
| Molecular Formula | C26H29ClN2O5 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(3R,11S)-3-(2-methoxyphenyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetamide |
| SMILES | COc1ccccc1[C@@H]1COC(=O)[C@H](CC(=O)NCc2ccc(Cl)cc2)CC=CCCC(=O)N1 |
| InChI | InChI=1S/C26H29ClN2O5/c1-33-23-9-6-5-8-21(23)22-17-34-26(32)19(7-3-2-4-10-24(30)29-22)15-25(31)28-16-18-11-13-20(27)14-12-18/h2-3,5-6,8-9,11-14,19,22H,4,7,10,15-17H2,1H3,(H,28,31)(H,29,30)/t19-,22-/m0/s1 |
| InChIKey | ONTBLYWKSYBRCL-UGKGYDQZSA-N |
| XLogP | 4.11 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|