C13H16N2O3 — CID 140705543
(4-ethylphenyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate (PubChem CID 140705543) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is (4-ethylphenyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate.
| Compound Name | (4-ethylphenyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 140705543 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (4-ethylphenyl) N-methyl-N-[(3S)-2-oxoazetidin-3-yl]carbamate |
| SMILES | CCc1ccc(OC(=O)N(C)[C@H]2CNC2=O)cc1 |
| InChI | InChI=1S/C13H16N2O3/c1-3-9-4-6-10(7-5-9)18-13(17)15(2)11-8-14-12(11)16/h4-7,11H,3,8H2,1-2H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | OEOLLOSGFKRYPC-NSHDSACASA-N |
| XLogP | 1.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |