C18H32O — CID 140708568
1,1,2,2,8,9,9-heptamethyl-4,5,6,6a,7,8-hexahydro-3aH-cyclopenta[d][1]benzofuran (PubChem CID 140708568) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is 1,1,2,2,8,9,9-heptamethyl-4,5,6,6a,7,8-hexahydro-3aH-cyclopenta[d][1]benzofuran.
| Compound Name | 1,1,2,2,8,9,9-heptamethyl-4,5,6,6a,7,8-hexahydro-3aH-cyclopenta[d][1]benzofuran |
|---|---|
| PubChem CID | 140708568 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 1,1,2,2,8,9,9-heptamethyl-4,5,6,6a,7,8-hexahydro-3aH-cyclopenta[d][1]benzofuran |
| SMILES | CC1CC2CCCC3OC(C)(C)C(C)(C)C23C1(C)C |
| InChI | InChI=1S/C18H32O/c1-12-11-13-9-8-10-14-18(13,15(12,2)3)16(4,5)17(6,7)19-14/h12-14H,8-11H2,1-7H3 |
| InChIKey | GQPPQNFGRFJIFJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |