C14H24O2 — CID 135037220
(9R)-7,7,13-trimethyl-6,8-dioxatricyclo[7.4.0.01,5]tridecane (PubChem CID 135037220) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (9R)-7,7,13-trimethyl-6,8-dioxatricyclo[7.4.0.01,5]tridecane.
| Compound Name | (9R)-7,7,13-trimethyl-6,8-dioxatricyclo[7.4.0.01,5]tridecane |
|---|---|
| PubChem CID | 135037220 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (9R)-7,7,13-trimethyl-6,8-dioxatricyclo[7.4.0.01,5]tridecane |
| SMILES | CC1CCC[C@H]2OC(C)(C)OC3CCCC132 |
| InChI | InChI=1S/C14H24O2/c1-10-6-4-7-11-14(10)9-5-8-12(14)16-13(2,3)15-11/h10-12H,4-9H2,1-3H3/t10?,11-,12?,14?/m1/s1 |
| InChIKey | HTVOJQNACNLIJA-FUWMQMHUSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |