C15H19OS+ — CID 140711598
1-(4-methoxy-6,7-dihydronaphthalen-1-yl)thiolan-1-ium (PubChem CID 140711598) has the molecular formula C15H19OS+ and a molecular weight of 247.38 g/mol. Its IUPAC name is 1-(4-methoxy-6,7-dihydronaphthalen-1-yl)thiolan-1-ium.
| Compound Name | 1-(4-methoxy-6,7-dihydronaphthalen-1-yl)thiolan-1-ium |
|---|---|
| PubChem CID | 140711598 |
| Molecular Formula | C15H19OS+ |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1-(4-methoxy-6,7-dihydronaphthalen-1-yl)thiolan-1-ium |
| SMILES | COc1ccc([S+]2CCCC2)c2c1=CCCC=2 |
| InChI | InChI=1S/C15H19OS/c1-16-14-8-9-15(17-10-4-5-11-17)13-7-3-2-6-12(13)14/h6-9H,2-5,10-11H2,1H3/q+1 |
| InChIKey | IGAHFAFEQXOWRB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|