C21H27OS+ — CID 176774457
cyclohexa-1,5-dien-1-yl-cyclohexa-2,4-dien-1-yl-[(3Z,5Z)-5-methoxy-4-methylhepta-1,3,5-trien-2-yl]sulfanium (PubChem CID 176774457) has the molecular formula C21H27OS+ and a molecular weight of 327.51 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl-cyclohexa-2,4-dien-1-yl-[(3Z,5Z)-5-methoxy-4-methylhepta-1,3,5-trien-2-yl]sulfanium.
| Compound Name | cyclohexa-1,5-dien-1-yl-cyclohexa-2,4-dien-1-yl-[(3Z,5Z)-5-methoxy-4-methylhepta-1,3,5-trien-2-yl]sulfanium |
|---|---|
| PubChem CID | 176774457 |
| Molecular Formula | C21H27OS+ |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl-cyclohexa-2,4-dien-1-yl-[(3Z,5Z)-5-methoxy-4-methylhepta-1,3,5-trien-2-yl]sulfanium |
| SMILES | C=C(/C=C(C)\C(=C\C)OC)[S+](C1=CCCC=C1)C1C=CC=CC1 |
| InChI | InChI=1S/C21H27OS/c1-5-21(22-4)17(2)16-18(3)23(19-12-8-6-9-13-19)20-14-10-7-11-15-20/h5-6,8-10,12,14-16,19H,3,7,11,13H2,1-2,4H3/q+1/b17-16-,21-5- |
| InChIKey | SQXYMCZLTRZOGV-GHPBHYPLSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|